C16H27F2NO — CID 123227190
N-[1-(2-ethylidene-6,7-difluorohepta-4,6-dienoxy)ethyl]-N-methylbutan-2-amine (PubChem CID 123227190) has the molecular formula C16H27F2NO and a molecular weight of 287.39 g/mol. Its IUPAC name is N-[1-(2-ethylidene-6,7-difluorohepta-4,6-dienoxy)ethyl]-N-methylbutan-2-amine.
| Compound Name | N-[1-(2-ethylidene-6,7-difluorohepta-4,6-dienoxy)ethyl]-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 123227190 |
| Molecular Formula | C16H27F2NO |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | N-[1-(2-ethylidene-6,7-difluorohepta-4,6-dienoxy)ethyl]-N-methylbutan-2-amine |
| SMILES | CC=C(CC=CC(F)=CF)COC(C)N(C)C(C)CC |
| InChI | InChI=1S/C16H27F2NO/c1-6-13(3)19(5)14(4)20-12-15(7-2)9-8-10-16(18)11-17/h7-8,10-11,13-14H,6,9,12H2,1-5H3 |
| InChIKey | WBPMHOHENKBPJQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|