C18H30ClNO — CID 142550004
(Z,2E)-N-butyl-5-chloro-2-ethylidene-N-[(2E,4Z)-6-methoxyhexa-2,4-dien-3-yl]pent-3-en-1-amine (PubChem CID 142550004) has the molecular formula C18H30ClNO and a molecular weight of 311.90 g/mol. Its IUPAC name is (Z,2E)-N-butyl-5-chloro-2-ethylidene-N-[(2E,4Z)-6-methoxyhexa-2,4-dien-3-yl]pent-3-en-1-amine.
| Compound Name | (Z,2E)-N-butyl-5-chloro-2-ethylidene-N-[(2E,4Z)-6-methoxyhexa-2,4-dien-3-yl]pent-3-en-1-amine |
|---|---|
| PubChem CID | 142550004 |
| Molecular Formula | C18H30ClNO |
| Molecular Weight | 311.90 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | (Z,2E)-N-butyl-5-chloro-2-ethylidene-N-[(2E,4Z)-6-methoxyhexa-2,4-dien-3-yl]pent-3-en-1-amine |
| SMILES | C/C=C(\C=C/CCl)CN(CCCC)C(/C=C\COC)=C/C |
| InChI | InChI=1S/C18H30ClNO/c1-5-8-14-20(16-17(6-2)11-9-13-19)18(7-3)12-10-15-21-4/h6-7,9-12H,5,8,13-16H2,1-4H3/b11-9-,12-10-,17-6+,18-7+ |
| InChIKey | QNAVBRZAXXAHMG-RQPCUISGSA-N |
| XLogP | 4.94 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.90 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|