C21H35NO — CID 142550010
(Z,2E)-2-ethylidene-5-methoxy-N-[(1E,3Z)-4-methylhexa-1,3,5-trienyl]-N-pentylhex-3-en-1-amine (PubChem CID 142550010) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is (Z,2E)-2-ethylidene-5-methoxy-N-[(1E,3Z)-4-methylhexa-1,3,5-trienyl]-N-pentylhex-3-en-1-amine.
| Compound Name | (Z,2E)-2-ethylidene-5-methoxy-N-[(1E,3Z)-4-methylhexa-1,3,5-trienyl]-N-pentylhex-3-en-1-amine |
|---|---|
| PubChem CID | 142550010 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | (Z,2E)-2-ethylidene-5-methoxy-N-[(1E,3Z)-4-methylhexa-1,3,5-trienyl]-N-pentylhex-3-en-1-amine |
| SMILES | C=C/C(C)=C\C=C\N(CCCCC)CC(/C=C\C(C)OC)=C/C |
| InChI | InChI=1S/C21H35NO/c1-7-10-11-16-22(17-12-13-19(4)8-2)18-21(9-3)15-14-20(5)23-6/h8-9,12-15,17,20H,2,7,10-11,16,18H2,1,3-6H3/b15-14-,17-12+,19-13-,21-9+ |
| InChIKey | XAWRQKZRQNMLOO-MNNVBQSISA-N |
| XLogP | 5.66 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|