C17H33NO — CID 14814091
(Z)-2-(1-ethoxybut-3-enyl)-N,N-diethylhept-2-en-1-amine (PubChem CID 14814091) has the molecular formula C17H33NO and a molecular weight of 267.46 g/mol. Its IUPAC name is (Z)-2-(1-ethoxybut-3-enyl)-N,N-diethylhept-2-en-1-amine.
| Compound Name | (Z)-2-(1-ethoxybut-3-enyl)-N,N-diethylhept-2-en-1-amine |
|---|---|
| PubChem CID | 14814091 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | (Z)-2-(1-ethoxybut-3-enyl)-N,N-diethylhept-2-en-1-amine |
| SMILES | C=CCC(OCC)/C(=C\CCCC)CN(CC)CC |
| InChI | InChI=1S/C17H33NO/c1-6-11-12-14-16(15-18(8-3)9-4)17(13-7-2)19-10-5/h7,14,17H,2,6,8-13,15H2,1,3-5H3/b16-14- |
| InChIKey | UWCWHCRKSHDHCS-PEZBUJJGSA-N |
| XLogP | 4.43 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|