C33H65NO — CID 142087458
ethane;4-[(3E,6E)-4-ethenyl-6-[(Z)-prop-1-enyl]nona-1,3,6,8-tetraen-5-yl]oxy-1-methylpiperidine;prop-1-ene (PubChem CID 142087458) has the molecular formula C33H65NO and a molecular weight of 491.89 g/mol. Its IUPAC name is ethane;4-[(3E,6E)-4-ethenyl-6-[(Z)-prop-1-enyl]nona-1,3,6,8-tetraen-5-yl]oxy-1-methylpiperidine;prop-1-ene.
| Compound Name | ethane;4-[(3E,6E)-4-ethenyl-6-[(Z)-prop-1-enyl]nona-1,3,6,8-tetraen-5-yl]oxy-1-methylpiperidine;prop-1-ene |
|---|---|
| PubChem CID | 142087458 |
| Molecular Formula | C33H65NO |
| Molecular Weight | 491.89 g/mol |
| Exact Mass | 491.51 |
| IUPAC Name | ethane;4-[(3E,6E)-4-ethenyl-6-[(Z)-prop-1-enyl]nona-1,3,6,8-tetraen-5-yl]oxy-1-methylpiperidine;prop-1-ene |
| SMILES | C=C/C=C(\C=C)C(OC1CCN(C)CC1)C(/C=C\C)=C/C=C.C=CC.CC.CC.CC.CC.CC |
| InChI | InChI=1S/C20H29NO.C3H6.5C2H6/c1-6-10-17(9-4)20(18(11-7-2)12-8-3)22-19-13-15-21(5)16-14-19;1-3-2;5*1-2/h6-12,19-20H,1-2,4,13-16H2,3,5H3;3H,1H2,2H3;5*1-2H3/b12-8-,17-10+,18-11+;;;;;; |
| InChIKey | UXEDCUWHIPSGOW-WEDFNEBMSA-N |
| XLogP | 10.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.89 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|