C18H31NO — CID 156641407
4-[(2E,4E)-4,5-dimethyl-2-[(Z)-prop-1-enyl]hepta-2,4-dienoxy]-1-methylpiperidine (PubChem CID 156641407) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is 4-[(2E,4E)-4,5-dimethyl-2-[(Z)-prop-1-enyl]hepta-2,4-dienoxy]-1-methylpiperidine.
| Compound Name | 4-[(2E,4E)-4,5-dimethyl-2-[(Z)-prop-1-enyl]hepta-2,4-dienoxy]-1-methylpiperidine |
|---|---|
| PubChem CID | 156641407 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 4-[(2E,4E)-4,5-dimethyl-2-[(Z)-prop-1-enyl]hepta-2,4-dienoxy]-1-methylpiperidine |
| SMILES | C/C=C\C(=C/C(C)=C(\C)CC)COC1CCN(C)CC1 |
| InChI | InChI=1S/C18H31NO/c1-6-8-17(13-16(4)15(3)7-2)14-20-18-9-11-19(5)12-10-18/h6,8,13,18H,7,9-12,14H2,1-5H3/b8-6-,16-15+,17-13+ |
| InChIKey | YDICMUDHEGEGAK-OZMGIFFASA-N |
| XLogP | 4.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|