C14H23NO — CID 57115460
1-(3-cyclohexa-2,5-dien-1-yloxypropyl)piperidine (PubChem CID 57115460) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 1-(3-cyclohexa-2,5-dien-1-yloxypropyl)piperidine.
| Compound Name | 1-(3-cyclohexa-2,5-dien-1-yloxypropyl)piperidine |
|---|---|
| PubChem CID | 57115460 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 1-(3-cyclohexa-2,5-dien-1-yloxypropyl)piperidine |
| SMILES | C1=CC(OCCCN2CCCCC2)C=CC1 |
| InChI | InChI=1S/C14H23NO/c1-3-8-14(9-4-1)16-13-7-12-15-10-5-2-6-11-15/h3-4,8-9,14H,1-2,5-7,10-13H2 |
| InChIKey | LIVFQYHFBMNSCE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|