C13H20BrNO — CID 142283549
1-(2-bromoethyl)-4-cyclohexa-1,5-dien-1-yloxypiperidine (PubChem CID 142283549) has the molecular formula C13H20BrNO and a molecular weight of 286.21 g/mol. Its IUPAC name is 1-(2-bromoethyl)-4-cyclohexa-1,5-dien-1-yloxypiperidine.
| Compound Name | 1-(2-bromoethyl)-4-cyclohexa-1,5-dien-1-yloxypiperidine |
|---|---|
| PubChem CID | 142283549 |
| Molecular Formula | C13H20BrNO |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 1-(2-bromoethyl)-4-cyclohexa-1,5-dien-1-yloxypiperidine |
| SMILES | BrCCN1CCC(OC2=CCCC=C2)CC1 |
| InChI | InChI=1S/C13H20BrNO/c14-8-11-15-9-6-13(7-10-15)16-12-4-2-1-3-5-12/h2,4-5,13H,1,3,6-11H2 |
| InChIKey | GRGOPGAGJAVVKZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|