C13H21NO2 — CID 142283541
2-(4-cyclohexa-1,5-dien-1-yloxypiperidin-1-yl)ethanol (PubChem CID 142283541) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-(4-cyclohexa-1,5-dien-1-yloxypiperidin-1-yl)ethanol.
| Compound Name | 2-(4-cyclohexa-1,5-dien-1-yloxypiperidin-1-yl)ethanol |
|---|---|
| PubChem CID | 142283541 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 2-(4-cyclohexa-1,5-dien-1-yloxypiperidin-1-yl)ethanol |
| SMILES | OCCN1CCC(OC2=CCCC=C2)CC1 |
| InChI | InChI=1S/C13H21NO2/c15-11-10-14-8-6-13(7-9-14)16-12-4-2-1-3-5-12/h2,4-5,13,15H,1,3,6-11H2 |
| InChIKey | GRIUFTRNKXXZDT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |