C31H47NO — CID 153381719
ethane;(2E,3Z)-2-ethylidene-4-[(3Z,5Z)-5-ethylidene-7-methylocta-1,3-dien-2-yl]-3-(2-methoxyethylidene)-1-[(2E,4Z)-2-prop-1-en-2-ylhexa-2,4-dienyl]pyrrole (PubChem CID 153381719) has the molecular formula C31H47NO and a molecular weight of 449.72 g/mol. Its IUPAC name is ethane;(2E,3Z)-2-ethylidene-4-[(3Z,5Z)-5-ethylidene-7-methylocta-1,3-dien-2-yl]-3-(2-methoxyethylidene)-1-[(2E,4Z)-2-prop-1-en-2-ylhexa-2,4-dienyl]pyrrole.
| Compound Name | ethane;(2E,3Z)-2-ethylidene-4-[(3Z,5Z)-5-ethylidene-7-methylocta-1,3-dien-2-yl]-3-(2-methoxyethylidene)-1-[(2E,4Z)-2-prop-1-en-2-ylhexa-2,4-dienyl]pyrrole |
|---|---|
| PubChem CID | 153381719 |
| Molecular Formula | C31H47NO |
| Molecular Weight | 449.72 g/mol |
| Exact Mass | 449.37 |
| IUPAC Name | ethane;(2E,3Z)-2-ethylidene-4-[(3Z,5Z)-5-ethylidene-7-methylocta-1,3-dien-2-yl]-3-(2-methoxyethylidene)-1-[(2E,4Z)-2-prop-1-en-2-ylhexa-2,4-dienyl]pyrrole |
| SMILES | C=C(C)/C(=C\C=C/C)Cn1cc(C(=C)/C=C\C(=C/C)CC(C)C)c(=C/COC)/c1=C\C.CC |
| InChI | InChI=1S/C29H41NO.C2H6/c1-10-13-14-26(23(6)7)20-30-21-28(27(17-18-31-9)29(30)12-3)24(8)15-16-25(11-2)19-22(4)5;1-2/h10-17,21-22H,6,8,18-20H2,1-5,7,9H3;1-2H3/b13-10-,16-15-,25-11+,26-14-,27-17-,29-12+; |
| InChIKey | PUCXYEZFZKQGQD-VEIXWBMCSA-N |
| XLogP | 7.38 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.72 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|