C23H49NO — CID 142549968
butane;(Z,2E)-N-ethyl-2-ethylidene-N-hexan-2-yl-5-methoxypent-3-en-1-amine;propane (PubChem CID 142549968) has the molecular formula C23H49NO and a molecular weight of 355.65 g/mol. Its IUPAC name is butane;(Z,2E)-N-ethyl-2-ethylidene-N-hexan-2-yl-5-methoxypent-3-en-1-amine;propane.
| Compound Name | butane;(Z,2E)-N-ethyl-2-ethylidene-N-hexan-2-yl-5-methoxypent-3-en-1-amine;propane |
|---|---|
| PubChem CID | 142549968 |
| Molecular Formula | C23H49NO |
| Molecular Weight | 355.65 g/mol |
| Exact Mass | 355.38 |
| IUPAC Name | butane;(Z,2E)-N-ethyl-2-ethylidene-N-hexan-2-yl-5-methoxypent-3-en-1-amine;propane |
| SMILES | C/C=C(\C=C/COC)CN(CC)C(C)CCCC.CCC.CCCC |
| InChI | InChI=1S/C16H31NO.C4H10.C3H8/c1-6-9-11-15(4)17(8-3)14-16(7-2)12-10-13-18-5;1-3-4-2;1-3-2/h7,10,12,15H,6,8-9,11,13-14H2,1-5H3;3-4H2,1-2H3;3H2,1-2H3/b12-10-,16-7+;; |
| InChIKey | LEVKJIWPPJWHCQ-OZVNAIAVSA-N |
| XLogP | 7.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.65 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|