C21H39NO — CID 142550079
(Z,2E)-N-(cyclohexylmethyl)-2-ethylidene-N-hexyl-5-methoxypent-3-en-1-amine (PubChem CID 142550079) has the molecular formula C21H39NO and a molecular weight of 321.55 g/mol. Its IUPAC name is (Z,2E)-N-(cyclohexylmethyl)-2-ethylidene-N-hexyl-5-methoxypent-3-en-1-amine.
| Compound Name | (Z,2E)-N-(cyclohexylmethyl)-2-ethylidene-N-hexyl-5-methoxypent-3-en-1-amine |
|---|---|
| PubChem CID | 142550079 |
| Molecular Formula | C21H39NO |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 321.30 |
| IUPAC Name | (Z,2E)-N-(cyclohexylmethyl)-2-ethylidene-N-hexyl-5-methoxypent-3-en-1-amine |
| SMILES | C/C=C(\C=C/COC)CN(CCCCCC)CC1CCCCC1 |
| InChI | InChI=1S/C21H39NO/c1-4-6-7-11-16-22(19-21-13-9-8-10-14-21)18-20(5-2)15-12-17-23-3/h5,12,15,21H,4,6-11,13-14,16-19H2,1-3H3/b15-12-,20-5+ |
| InChIKey | DCGMPEJTHFEJOA-IKHRSAQBSA-N |
| XLogP | 5.60 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|