C18H36NO+ — CID 142980175
ethane;(2R)-2-ethyl-1-[2-[(Z,2E)-2-ethylidenepent-3-enoxy]ethyl]-1-methylpyrrolidin-1-ium (PubChem CID 142980175) has the molecular formula C18H36NO+ and a molecular weight of 282.49 g/mol. Its IUPAC name is ethane;(2R)-2-ethyl-1-[2-[(Z,2E)-2-ethylidenepent-3-enoxy]ethyl]-1-methylpyrrolidin-1-ium.
| Compound Name | ethane;(2R)-2-ethyl-1-[2-[(Z,2E)-2-ethylidenepent-3-enoxy]ethyl]-1-methylpyrrolidin-1-ium |
|---|---|
| PubChem CID | 142980175 |
| Molecular Formula | C18H36NO+ |
| Molecular Weight | 282.49 g/mol |
| Exact Mass | 282.28 |
| IUPAC Name | ethane;(2R)-2-ethyl-1-[2-[(Z,2E)-2-ethylidenepent-3-enoxy]ethyl]-1-methylpyrrolidin-1-ium |
| SMILES | C/C=C\C(=C/C)COCC[N+]1(C)CCC[C@H]1CC.CC |
| InChI | InChI=1S/C16H30NO.C2H6/c1-5-9-15(6-2)14-18-13-12-17(4)11-8-10-16(17)7-3;1-2/h5-6,9,16H,7-8,10-14H2,1-4H3;1-2H3/q+1;/b9-5-,15-6+;/t16-,17?;/m1./s1 |
| InChIKey | ODKIJAYQVBAYSS-XGUIATDFSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|