C16H30NO+ — CID 142980176
(2R)-2-ethyl-1-[2-[(Z,2E)-2-ethylidenepent-3-enoxy]ethyl]-1-methylpyrrolidin-1-ium (PubChem CID 142980176) has the molecular formula C16H30NO+ and a molecular weight of 252.42 g/mol. Its IUPAC name is (2R)-2-ethyl-1-[2-[(Z,2E)-2-ethylidenepent-3-enoxy]ethyl]-1-methylpyrrolidin-1-ium.
| Compound Name | (2R)-2-ethyl-1-[2-[(Z,2E)-2-ethylidenepent-3-enoxy]ethyl]-1-methylpyrrolidin-1-ium |
|---|---|
| PubChem CID | 142980176 |
| Molecular Formula | C16H30NO+ |
| Molecular Weight | 252.42 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | (2R)-2-ethyl-1-[2-[(Z,2E)-2-ethylidenepent-3-enoxy]ethyl]-1-methylpyrrolidin-1-ium |
| SMILES | C/C=C\C(=C/C)COCC[N+]1(C)CCC[C@H]1CC |
| InChI | InChI=1S/C16H30NO/c1-5-9-15(6-2)14-18-13-12-17(4)11-8-10-16(17)7-3/h5-6,9,16H,7-8,10-14H2,1-4H3/q+1/b9-5-,15-6+/t16-,17?/m1/s1 |
| InChIKey | OAYZXJSFBGGZSI-RZEKVTTJSA-N |
| XLogP | 3.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|