C17H29NO2 — CID 143464128
1-(2-methoxyethyl)pyrrolidine;(3E)-3-(prop-2-enoxymethyl)hexa-1,3,5-triene (PubChem CID 143464128) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 1-(2-methoxyethyl)pyrrolidine;(3E)-3-(prop-2-enoxymethyl)hexa-1,3,5-triene.
| Compound Name | 1-(2-methoxyethyl)pyrrolidine;(3E)-3-(prop-2-enoxymethyl)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 143464128 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 1-(2-methoxyethyl)pyrrolidine;(3E)-3-(prop-2-enoxymethyl)hexa-1,3,5-triene |
| SMILES | C=C/C=C(\C=C)COCC=C.COCCN1CCCC1 |
| InChI | InChI=1S/C10H14O.C7H15NO/c1-4-7-10(6-3)9-11-8-5-2;1-9-7-6-8-4-2-3-5-8/h4-7H,1-3,8-9H2;2-7H2,1H3/b10-7+; |
| InChIKey | MCMPXAAUFXRFPM-HCUGZAAXSA-N |
| XLogP | 3.22 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|