C28H39NO — CID 143378620
1-[2-[(3Z,6E,8E)-8-ethenyl-6-[(Z,1E)-1-ethylidenepent-2-enyl]-7-methyl-5-methylideneundeca-1,3,6,8,10-pentaen-2-yl]oxyethyl]pyrrolidine (PubChem CID 143378620) has the molecular formula C28H39NO and a molecular weight of 405.63 g/mol. Its IUPAC name is 1-[2-[(3Z,6E,8E)-8-ethenyl-6-[(Z,1E)-1-ethylidenepent-2-enyl]-7-methyl-5-methylideneundeca-1,3,6,8,10-pentaen-2-yl]oxyethyl]pyrrolidine.
| Compound Name | 1-[2-[(3Z,6E,8E)-8-ethenyl-6-[(Z,1E)-1-ethylidenepent-2-enyl]-7-methyl-5-methylideneundeca-1,3,6,8,10-pentaen-2-yl]oxyethyl]pyrrolidine |
|---|---|
| PubChem CID | 143378620 |
| Molecular Formula | C28H39NO |
| Molecular Weight | 405.63 g/mol |
| Exact Mass | 405.30 |
| IUPAC Name | 1-[2-[(3Z,6E,8E)-8-ethenyl-6-[(Z,1E)-1-ethylidenepent-2-enyl]-7-methyl-5-methylideneundeca-1,3,6,8,10-pentaen-2-yl]oxyethyl]pyrrolidine |
| SMILES | C=C/C=C(C=C)/C(C)=C(\C(=C)/C=C\C(=C)OCCN1CCCC1)C(=CC)/C=C\CC |
| InChI | InChI=1S/C28H39NO/c1-8-12-16-27(11-4)28(25(7)26(10-3)15-9-2)23(5)17-18-24(6)30-22-21-29-19-13-14-20-29/h9-12,15-18H,2-3,5-6,8,13-14,19-22H2,1,4,7H3/b16-12-,18-17-,26-15+,27-11+,28-25+ |
| InChIKey | JPFVIVHVOXCLNG-SPLQARMESA-N |
| XLogP | 7.25 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.63 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|