C17H31NO — CID 143435434
1-butyl-2-[[(2Z,4Z)-4-ethylhexa-2,4-dienoxy]methyl]pyrrolidine (PubChem CID 143435434) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is 1-butyl-2-[[(2Z,4Z)-4-ethylhexa-2,4-dienoxy]methyl]pyrrolidine.
| Compound Name | 1-butyl-2-[[(2Z,4Z)-4-ethylhexa-2,4-dienoxy]methyl]pyrrolidine |
|---|---|
| PubChem CID | 143435434 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | 1-butyl-2-[[(2Z,4Z)-4-ethylhexa-2,4-dienoxy]methyl]pyrrolidine |
| SMILES | C/C=C(\C=C/COCC1CCCN1CCCC)CC |
| InChI | InChI=1S/C17H31NO/c1-4-7-12-18-13-8-11-17(18)15-19-14-9-10-16(5-2)6-3/h5,9-10,17H,4,6-8,11-15H2,1-3H3/b10-9-,16-5- |
| InChIKey | OYCPNPDQKZZNCG-NPPIHSNYSA-N |
| XLogP | 4.18 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|