C17H35NO — CID 151436173
N,N-diethyl-1-methoxydodec-2-en-4-amine (PubChem CID 151436173) has the molecular formula C17H35NO and a molecular weight of 269.47 g/mol. Its IUPAC name is N,N-diethyl-1-methoxydodec-2-en-4-amine.
| Compound Name | N,N-diethyl-1-methoxydodec-2-en-4-amine |
|---|---|
| PubChem CID | 151436173 |
| Molecular Formula | C17H35NO |
| Molecular Weight | 269.47 g/mol |
| Exact Mass | 269.27 |
| IUPAC Name | N,N-diethyl-1-methoxydodec-2-en-4-amine |
| SMILES | CCCCCCCCC(C=CCOC)N(CC)CC |
| InChI | InChI=1S/C17H35NO/c1-5-8-9-10-11-12-14-17(15-13-16-19-4)18(6-2)7-3/h13,15,17H,5-12,14,16H2,1-4H3 |
| InChIKey | PDNVBFDMUDJYPQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|