C18H37NO2 — CID 151410232
N,N-diethyl-1,1-dimethoxydodec-2-en-4-amine (PubChem CID 151410232) has the molecular formula C18H37NO2 and a molecular weight of 299.50 g/mol. Its IUPAC name is N,N-diethyl-1,1-dimethoxydodec-2-en-4-amine.
| Compound Name | N,N-diethyl-1,1-dimethoxydodec-2-en-4-amine |
|---|---|
| PubChem CID | 151410232 |
| Molecular Formula | C18H37NO2 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.28 |
| IUPAC Name | N,N-diethyl-1,1-dimethoxydodec-2-en-4-amine |
| SMILES | CCCCCCCCC(C=CC(OC)OC)N(CC)CC |
| InChI | InChI=1S/C18H37NO2/c1-6-9-10-11-12-13-14-17(19(7-2)8-3)15-16-18(20-4)21-5/h15-18H,6-14H2,1-5H3 |
| InChIKey | OYIYSLGBMKVVAK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|