C19H39NO2 — CID 172686686
1,1-diethoxy-N,N-dimethyltridec-2-en-4-amine (PubChem CID 172686686) has the molecular formula C19H39NO2 and a molecular weight of 313.53 g/mol. Its IUPAC name is 1,1-diethoxy-N,N-dimethyltridec-2-en-4-amine.
| Compound Name | 1,1-diethoxy-N,N-dimethyltridec-2-en-4-amine |
|---|---|
| PubChem CID | 172686686 |
| Molecular Formula | C19H39NO2 |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.30 |
| IUPAC Name | 1,1-diethoxy-N,N-dimethyltridec-2-en-4-amine |
| SMILES | CCCCCCCCCC(C=CC(OCC)OCC)N(C)C |
| InChI | InChI=1S/C19H39NO2/c1-6-9-10-11-12-13-14-15-18(20(4)5)16-17-19(21-7-2)22-8-3/h16-19H,6-15H2,1-5H3 |
| InChIKey | BCZRWAVQGWGWHC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|