C21H37NO — CID 176934058
ethane;(2Z,3E)-3-[(1Z)-3-ethoxy-2-methylbuta-1,3-dienyl]-N-ethyl-2-ethylidene-N-methylhepta-3,6-dien-1-amine (PubChem CID 176934058) has the molecular formula C21H37NO and a molecular weight of 319.53 g/mol. Its IUPAC name is ethane;(2Z,3E)-3-[(1Z)-3-ethoxy-2-methylbuta-1,3-dienyl]-N-ethyl-2-ethylidene-N-methylhepta-3,6-dien-1-amine.
| Compound Name | ethane;(2Z,3E)-3-[(1Z)-3-ethoxy-2-methylbuta-1,3-dienyl]-N-ethyl-2-ethylidene-N-methylhepta-3,6-dien-1-amine |
|---|---|
| PubChem CID | 176934058 |
| Molecular Formula | C21H37NO |
| Molecular Weight | 319.53 g/mol |
| Exact Mass | 319.29 |
| IUPAC Name | ethane;(2Z,3E)-3-[(1Z)-3-ethoxy-2-methylbuta-1,3-dienyl]-N-ethyl-2-ethylidene-N-methylhepta-3,6-dien-1-amine |
| SMILES | C=CC/C=C(\C=C(\C)C(=C)OCC)C(=C/C)/CN(C)CC.CC |
| InChI | InChI=1S/C19H31NO.C2H6/c1-8-12-13-19(14-16(5)17(6)21-11-4)18(9-2)15-20(7)10-3;1-2/h8-9,13-14H,1,6,10-12,15H2,2-5,7H3;1-2H3/b16-14-,18-9+,19-13+; |
| InChIKey | TZOLMIXQVCPHNL-TUOAJYNGSA-N |
| XLogP | 5.91 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|