C16H32N2O — CID 143123502
N'-[(Z,2E)-2-ethylidenehex-3-enyl]-N-(3-methoxypropyl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 143123502) has the molecular formula C16H32N2O and a molecular weight of 268.44 g/mol. Its IUPAC name is N'-[(Z,2E)-2-ethylidenehex-3-enyl]-N-(3-methoxypropyl)-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-[(Z,2E)-2-ethylidenehex-3-enyl]-N-(3-methoxypropyl)-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 143123502 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | N'-[(Z,2E)-2-ethylidenehex-3-enyl]-N-(3-methoxypropyl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | C/C=C(\C=C/CC)CN(C)CCN(C)CCCOC |
| InChI | InChI=1S/C16H32N2O/c1-6-8-10-16(7-2)15-18(4)13-12-17(3)11-9-14-19-5/h7-8,10H,6,9,11-15H2,1-5H3/b10-8-,16-7+ |
| InChIKey | RDKOEYMFJMUEFW-XHYHITDASA-N |
| XLogP | 2.80 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|