C16H32N2O — CID 171071700
N-(3-methoxypropyl)-N,N'-dimethyl-N'-[(2E,4Z)-5-methylhepta-2,4-dien-2-yl]ethane-1,2-diamine (PubChem CID 171071700) has the molecular formula C16H32N2O and a molecular weight of 268.44 g/mol. Its IUPAC name is N-(3-methoxypropyl)-N,N'-dimethyl-N'-[(2E,4Z)-5-methylhepta-2,4-dien-2-yl]ethane-1,2-diamine.
| Compound Name | N-(3-methoxypropyl)-N,N'-dimethyl-N'-[(2E,4Z)-5-methylhepta-2,4-dien-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 171071700 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | N-(3-methoxypropyl)-N,N'-dimethyl-N'-[(2E,4Z)-5-methylhepta-2,4-dien-2-yl]ethane-1,2-diamine |
| SMILES | CC/C(C)=C\C=C(/C)N(C)CCN(C)CCCOC |
| InChI | InChI=1S/C16H32N2O/c1-7-15(2)9-10-16(3)18(5)13-12-17(4)11-8-14-19-6/h9-10H,7-8,11-14H2,1-6H3/b15-9-,16-10+ |
| InChIKey | ILKPOKFRNZJHKQ-CKOAPEAFSA-N |
| XLogP | 3.15 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|