C18H36N2O — CID 156866585
ethane;N'-(4-ethylcyclohexa-1,3-dien-1-yl)-N-(3-methoxypropyl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 156866585) has the molecular formula C18H36N2O and a molecular weight of 296.50 g/mol. Its IUPAC name is ethane;N'-(4-ethylcyclohexa-1,3-dien-1-yl)-N-(3-methoxypropyl)-N,N'-dimethylethane-1,2-diamine.
| Compound Name | ethane;N'-(4-ethylcyclohexa-1,3-dien-1-yl)-N-(3-methoxypropyl)-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 156866585 |
| Molecular Formula | C18H36N2O |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.28 |
| IUPAC Name | ethane;N'-(4-ethylcyclohexa-1,3-dien-1-yl)-N-(3-methoxypropyl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | CC.CCC1=CC=C(N(C)CCN(C)CCCOC)CC1 |
| InChI | InChI=1S/C16H30N2O.C2H6/c1-5-15-7-9-16(10-8-15)18(3)13-12-17(2)11-6-14-19-4;1-2/h7,9H,5-6,8,10-14H2,1-4H3;1-2H3 |
| InChIKey | WAXZCNVMTNIGIE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|