C19H37NO — CID 143587806
ethane;N-(3-ethoxypropyl)-5-ethyl-N-methylcyclohepta-1,4,6-trien-1-amine (PubChem CID 143587806) has the molecular formula C19H37NO and a molecular weight of 295.51 g/mol. Its IUPAC name is ethane;N-(3-ethoxypropyl)-5-ethyl-N-methylcyclohepta-1,4,6-trien-1-amine.
| Compound Name | ethane;N-(3-ethoxypropyl)-5-ethyl-N-methylcyclohepta-1,4,6-trien-1-amine |
|---|---|
| PubChem CID | 143587806 |
| Molecular Formula | C19H37NO |
| Molecular Weight | 295.51 g/mol |
| Exact Mass | 295.29 |
| IUPAC Name | ethane;N-(3-ethoxypropyl)-5-ethyl-N-methylcyclohepta-1,4,6-trien-1-amine |
| SMILES | CC.CC.CCOCCCN(C)C1=CCC=C(CC)C=C1 |
| InChI | InChI=1S/C15H25NO.2C2H6/c1-4-14-8-6-9-15(11-10-14)16(3)12-7-13-17-5-2;2*1-2/h8-11H,4-7,12-13H2,1-3H3;2*1-2H3 |
| InChIKey | KYUJJGIDMSMWMD-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|