C23H43NO — CID 143159488
ethane;(2Z)-6-methoxy-2-methyl-N-octa-1,7-dien-2-ylocta-2,7-dien-1-amine;prop-1-ene (PubChem CID 143159488) has the molecular formula C23H43NO and a molecular weight of 349.60 g/mol. Its IUPAC name is ethane;(2Z)-6-methoxy-2-methyl-N-octa-1,7-dien-2-ylocta-2,7-dien-1-amine;prop-1-ene.
| Compound Name | ethane;(2Z)-6-methoxy-2-methyl-N-octa-1,7-dien-2-ylocta-2,7-dien-1-amine;prop-1-ene |
|---|---|
| PubChem CID | 143159488 |
| Molecular Formula | C23H43NO |
| Molecular Weight | 349.60 g/mol |
| Exact Mass | 349.33 |
| IUPAC Name | ethane;(2Z)-6-methoxy-2-methyl-N-octa-1,7-dien-2-ylocta-2,7-dien-1-amine;prop-1-ene |
| SMILES | C=CC.C=CCCCCC(=C)NC/C(C)=C\CCC(C=C)OC.CC |
| InChI | InChI=1S/C18H31NO.C3H6.C2H6/c1-6-8-9-10-13-17(4)19-15-16(3)12-11-14-18(7-2)20-5;1-3-2;1-2/h6-7,12,18-19H,1-2,4,8-11,13-15H2,3,5H3;3H,1H2,2H3;1-2H3/b16-12-;; |
| InChIKey | ZUPWLSOPYDZXBR-DAANKRAASA-N |
| XLogP | 6.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.60 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|