C18H31NO — CID 143159489
(2Z)-6-methoxy-2-methyl-N-octa-1,7-dien-2-ylocta-2,7-dien-1-amine (PubChem CID 143159489) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is (2Z)-6-methoxy-2-methyl-N-octa-1,7-dien-2-ylocta-2,7-dien-1-amine.
| Compound Name | (2Z)-6-methoxy-2-methyl-N-octa-1,7-dien-2-ylocta-2,7-dien-1-amine |
|---|---|
| PubChem CID | 143159489 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | (2Z)-6-methoxy-2-methyl-N-octa-1,7-dien-2-ylocta-2,7-dien-1-amine |
| SMILES | C=CCCCCC(=C)NC/C(C)=C\CCC(C=C)OC |
| InChI | InChI=1S/C18H31NO/c1-6-8-9-10-13-17(4)19-15-16(3)12-11-14-18(7-2)20-5/h6-7,12,18-19H,1-2,4,8-11,13-15H2,3,5H3/b16-12- |
| InChIKey | JOGCZMUUMGTOQX-VBKFSLOCSA-N |
| XLogP | 4.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|