C14H27NO2 — CID 144515476
2-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]-N,N-dimethylethanamine (PubChem CID 144515476) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is 2-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 144515476 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | 2-[(2Z)-6-methoxy-2-methylocta-2,7-dienoxy]-N,N-dimethylethanamine |
| SMILES | C=CC(CC/C=C(/C)COCCN(C)C)OC |
| InChI | InChI=1S/C14H27NO2/c1-6-14(16-5)9-7-8-13(2)12-17-11-10-15(3)4/h6,8,14H,1,7,9-12H2,2-5H3/b13-8- |
| InChIKey | ITLWCBQYQMVCKX-JYRVWZFOSA-N |
| XLogP | 2.49 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|