C17H33NO2 — CID 144515564
ethane;(7E,12Z)-9-methoxy-4,13-dimethyl-1-oxa-4-azacyclotetradeca-7,12-diene (PubChem CID 144515564) has the molecular formula C17H33NO2 and a molecular weight of 283.46 g/mol. Its IUPAC name is ethane;(7E,12Z)-9-methoxy-4,13-dimethyl-1-oxa-4-azacyclotetradeca-7,12-diene.
| Compound Name | ethane;(7E,12Z)-9-methoxy-4,13-dimethyl-1-oxa-4-azacyclotetradeca-7,12-diene |
|---|---|
| PubChem CID | 144515564 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | ethane;(7E,12Z)-9-methoxy-4,13-dimethyl-1-oxa-4-azacyclotetradeca-7,12-diene |
| SMILES | CC.COC1/C=C/CCN(C)CCOC/C(C)=C\CC1 |
| InChI | InChI=1S/C15H27NO2.C2H6/c1-14-7-6-9-15(17-3)8-4-5-10-16(2)11-12-18-13-14;1-2/h4,7-8,15H,5-6,9-13H2,1-3H3;1-2H3/b8-4+,14-7-; |
| InChIKey | MVYGDWBBZQDHJZ-QMRVJPDPSA-N |
| XLogP | 3.66 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|