C21H37NO2 — CID 163793089
4-[2-(3,7,11-trimethyldodeca-2,6,10-trienoxy)ethyl]morpholine (PubChem CID 163793089) has the molecular formula C21H37NO2 and a molecular weight of 335.53 g/mol. Its IUPAC name is 4-[2-(3,7,11-trimethyldodeca-2,6,10-trienoxy)ethyl]morpholine.
| Compound Name | 4-[2-(3,7,11-trimethyldodeca-2,6,10-trienoxy)ethyl]morpholine |
|---|---|
| PubChem CID | 163793089 |
| Molecular Formula | C21H37NO2 |
| Molecular Weight | 335.53 g/mol |
| Exact Mass | 335.28 |
| IUPAC Name | 4-[2-(3,7,11-trimethyldodeca-2,6,10-trienoxy)ethyl]morpholine |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCOCCN1CCOCC1 |
| InChI | InChI=1S/C21H37NO2/c1-19(2)7-5-8-20(3)9-6-10-21(4)11-15-23-16-12-22-13-17-24-18-14-22/h7,9,11H,5-6,8,10,12-18H2,1-4H3 |
| InChIKey | MYNDYYXHIUXKSC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|