C24H41NO — CID 139662735
4-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]morpholine (PubChem CID 139662735) has the molecular formula C24H41NO and a molecular weight of 359.60 g/mol. Its IUPAC name is 4-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]morpholine.
| Compound Name | 4-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]morpholine |
|---|---|
| PubChem CID | 139662735 |
| Molecular Formula | C24H41NO |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 359.32 |
| IUPAC Name | 4-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]morpholine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CN1CCOCC1 |
| InChI | InChI=1S/C24H41NO/c1-21(2)9-6-10-22(3)11-7-12-23(4)13-8-14-24(5)15-16-25-17-19-26-20-18-25/h9,11,13,15H,6-8,10,12,14,16-20H2,1-5H3/b22-11+,23-13+,24-15+ |
| InChIKey | GLHBHLXTTBQPSA-QMCSRMPWSA-N |
| XLogP | 6.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|