C14H25NO — CID 73049864
4-(3,7-dimethylocta-2,6-dienyl)morpholine (PubChem CID 73049864) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is 4-(3,7-dimethylocta-2,6-dienyl)morpholine.
| Compound Name | 4-(3,7-dimethylocta-2,6-dienyl)morpholine |
|---|---|
| PubChem CID | 73049864 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 4-(3,7-dimethylocta-2,6-dienyl)morpholine |
| SMILES | CC(C)=CCCC(C)=CCN1CCOCC1 |
| InChI | InChI=1S/C14H25NO/c1-13(2)5-4-6-14(3)7-8-15-9-11-16-12-10-15/h5,7H,4,6,8-12H2,1-3H3 |
| InChIKey | YUTWIQSOWDYOKV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|