C15H25NO2 — CID 90443583
2-[(4E)-4-ethenyl-3-ethoxyhepta-1,4,6-trien-2-yl]oxy-N,N-dimethylethanamine (PubChem CID 90443583) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-[(4E)-4-ethenyl-3-ethoxyhepta-1,4,6-trien-2-yl]oxy-N,N-dimethylethanamine.
| Compound Name | 2-[(4E)-4-ethenyl-3-ethoxyhepta-1,4,6-trien-2-yl]oxy-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 90443583 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 2-[(4E)-4-ethenyl-3-ethoxyhepta-1,4,6-trien-2-yl]oxy-N,N-dimethylethanamine |
| SMILES | C=C/C=C(\C=C)C(OCC)C(=C)OCCN(C)C |
| InChI | InChI=1S/C15H25NO2/c1-7-10-14(8-2)15(17-9-3)13(4)18-12-11-16(5)6/h7-8,10,15H,1-2,4,9,11-12H2,3,5-6H3/b14-10+ |
| InChIKey | VGHVJSGQVHDNIU-GXDHUFHOSA-N |
| XLogP | 2.78 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|