C12H21NO — CID 154717594
N,N-diethyl-4-(2-methylprop-2-enyl)-2,5-dihydrofuran-2-amine (PubChem CID 154717594) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is N,N-diethyl-4-(2-methylprop-2-enyl)-2,5-dihydrofuran-2-amine.
| Compound Name | N,N-diethyl-4-(2-methylprop-2-enyl)-2,5-dihydrofuran-2-amine |
|---|---|
| PubChem CID | 154717594 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | N,N-diethyl-4-(2-methylprop-2-enyl)-2,5-dihydrofuran-2-amine |
| SMILES | C=C(C)CC1=CC(N(CC)CC)OC1 |
| InChI | InChI=1S/C12H21NO/c1-5-13(6-2)12-8-11(9-14-12)7-10(3)4/h8,12H,3,5-7,9H2,1-2,4H3 |
| InChIKey | ZNZQKNMGCNXFBR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|