C16H29NO — CID 154710504
N,N-dibutyl-4-(2-methylprop-2-enyl)-2,5-dihydrofuran-2-amine (PubChem CID 154710504) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is N,N-dibutyl-4-(2-methylprop-2-enyl)-2,5-dihydrofuran-2-amine.
| Compound Name | N,N-dibutyl-4-(2-methylprop-2-enyl)-2,5-dihydrofuran-2-amine |
|---|---|
| PubChem CID | 154710504 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | N,N-dibutyl-4-(2-methylprop-2-enyl)-2,5-dihydrofuran-2-amine |
| SMILES | C=C(C)CC1=CC(N(CCCC)CCCC)OC1 |
| InChI | InChI=1S/C16H29NO/c1-5-7-9-17(10-8-6-2)16-12-15(13-18-16)11-14(3)4/h12,16H,3,5-11,13H2,1-2,4H3 |
| InChIKey | ZGWUPBMPDNTJCT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|