C20H39NO — CID 16729186
(8E)-10-hexoxy-N,N,4,8-tetramethyldeca-4,8-dien-1-amine (PubChem CID 16729186) has the molecular formula C20H39NO and a molecular weight of 309.54 g/mol. Its IUPAC name is (8E)-10-hexoxy-N,N,4,8-tetramethyldeca-4,8-dien-1-amine.
| Compound Name | (8E)-10-hexoxy-N,N,4,8-tetramethyldeca-4,8-dien-1-amine |
|---|---|
| PubChem CID | 16729186 |
| Molecular Formula | C20H39NO |
| Molecular Weight | 309.54 g/mol |
| Exact Mass | 309.30 |
| IUPAC Name | (8E)-10-hexoxy-N,N,4,8-tetramethyldeca-4,8-dien-1-amine |
| SMILES | CCCCCCOC/C=C(\C)CCC=C(C)CCCN(C)C |
| InChI | InChI=1S/C20H39NO/c1-6-7-8-9-17-22-18-15-20(3)13-10-12-19(2)14-11-16-21(4)5/h12,15H,6-11,13-14,16-18H2,1-5H3/b19-12?,20-15+ |
| InChIKey | DYKXYQSMPCJKBO-PZCKQXFPSA-N |
| XLogP | 5.60 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.54 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|