C19H36LiNO — CID 156682918
lithium 3-[(2Z,6Z)-6-methanidyl-2-methyldodeca-2,6-dienoxy]-N,N-dimethylpropan-1-amine (PubChem CID 156682918) has the molecular formula C19H36LiNO and a molecular weight of 301.44 g/mol. Its IUPAC name is lithium 3-[(2Z,6Z)-6-methanidyl-2-methyldodeca-2,6-dienoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | lithium 3-[(2Z,6Z)-6-methanidyl-2-methyldodeca-2,6-dienoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 156682918 |
| Molecular Formula | C19H36LiNO |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.30 |
| IUPAC Name | lithium 3-[(2Z,6Z)-6-methanidyl-2-methyldodeca-2,6-dienoxy]-N,N-dimethylpropan-1-amine |
| SMILES | [CH2-]/C(=C/CCCCC)CC/C=C(/C)COCCCN(C)C.[Li+] |
| InChI | InChI=1S/C19H36NO.Li/c1-6-7-8-9-12-18(2)13-10-14-19(3)17-21-16-11-15-20(4)5;/h12,14H,2,6-11,13,15-17H2,1,3-5H3;/q-1;+1/b18-12-,19-14-; |
| InChIKey | DPUMZHQEJHCWGD-MYQGOODGSA-N |
| XLogP | 2.03 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|