C34H63LiN2O2 — CID 158338833
lithium;N,N-dimethyl-3-[(2E)-2-methyl-6-methylideneocta-2,7-dienoxy]propan-1-amine;3-[(2E,6Z)-6-methanidyl-2-methyldodeca-2,6-dienoxy]-N,N-dimethylpropan-1-amine (PubChem CID 158338833) has the molecular formula C34H63LiN2O2 and a molecular weight of 538.83 g/mol. Its IUPAC name is lithium;N,N-dimethyl-3-[(2E)-2-methyl-6-methylideneocta-2,7-dienoxy]propan-1-amine;3-[(2E,6Z)-6-methanidyl-2-methyldodeca-2,6-dienoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | lithium;N,N-dimethyl-3-[(2E)-2-methyl-6-methylideneocta-2,7-dienoxy]propan-1-amine;3-[(2E,6Z)-6-methanidyl-2-methyldodeca-2,6-dienoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 158338833 |
| Molecular Formula | C34H63LiN2O2 |
| Molecular Weight | 538.83 g/mol |
| Exact Mass | 538.50 |
| IUPAC Name | lithium;N,N-dimethyl-3-[(2E)-2-methyl-6-methylideneocta-2,7-dienoxy]propan-1-amine;3-[(2E,6Z)-6-methanidyl-2-methyldodeca-2,6-dienoxy]-N,N-dimethylpropan-1-amine |
| SMILES | C=CC(=C)CC/C=C(\C)COCCCN(C)C.[CH2-]/C(=C/CCCCC)CC/C=C(\C)COCCCN(C)C.[Li+] |
| InChI | InChI=1S/C19H36NO.C15H27NO.Li/c1-6-7-8-9-12-18(2)13-10-14-19(3)17-21-16-11-15-20(4)5;1-6-14(2)9-7-10-15(3)13-17-12-8-11-16(4)5;/h12,14H,2,6-11,13,15-17H2,1,3-5H3;6,10H,1-2,7-9,11-13H2,3-5H3;/q-1;;+1/b18-12-,19-14+;15-10+; |
| InChIKey | NPWDVZGUGGYPPZ-IUZZVRMZSA-N |
| XLogP | 5.45 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.83 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|