C34H63LiN2O2 — CID 156682910
lithium 3-[(2Z,6Z,10Z)-10-[(Z)-5-[3-(dimethylamino)propoxy]-4-methylpent-3-enyl]-6-methanidyl-2-methylhexadeca-2,6,10-trienoxy]-N,N-dimethylpropan-1-amine (PubChem CID 156682910) has the molecular formula C34H63LiN2O2 and a molecular weight of 538.83 g/mol. Its IUPAC name is lithium 3-[(2Z,6Z,10Z)-10-[(Z)-5-[3-(dimethylamino)propoxy]-4-methylpent-3-enyl]-6-methanidyl-2-methylhexadeca-2,6,10-trienoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | lithium 3-[(2Z,6Z,10Z)-10-[(Z)-5-[3-(dimethylamino)propoxy]-4-methylpent-3-enyl]-6-methanidyl-2-methylhexadeca-2,6,10-trienoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 156682910 |
| Molecular Formula | C34H63LiN2O2 |
| Molecular Weight | 538.83 g/mol |
| Exact Mass | 538.50 |
| IUPAC Name | lithium 3-[(2Z,6Z,10Z)-10-[(Z)-5-[3-(dimethylamino)propoxy]-4-methylpent-3-enyl]-6-methanidyl-2-methylhexadeca-2,6,10-trienoxy]-N,N-dimethylpropan-1-amine |
| SMILES | [CH2-]/C(=C/CC/C(=C/CCCCC)CC/C=C(/C)COCCCN(C)C)CC/C=C(/C)COCCCN(C)C.[Li+] |
| InChI | InChI=1S/C34H63N2O2.Li/c1-9-10-11-12-22-34(24-15-21-33(4)30-38-28-17-26-36(7)8)23-14-19-31(2)18-13-20-32(3)29-37-27-16-25-35(5)6;/h19-22H,2,9-18,23-30H2,1,3-8H3;/q-1;+1/b31-19-,32-20-,33-21-,34-22-; |
| InChIKey | ZFTFCLCPHCFSCU-NYHJVJOOSA-N |
| XLogP | 5.43 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.83 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|