About 2-methylpropoxymethyl hypochlorite
2-methylpropoxymethyl hypochlorite (PubChem CID 122692331) has the molecular formula C5H11ClO2
and a molecular weight of 138.59 g/mol. Its IUPAC name is 2-methylpropoxymethyl hypochlorite.
Molecular Properties
| Compound Name | 2-methylpropoxymethyl hypochlorite |
| PubChem CID | 122692331 |
| Molecular Formula | C5H11ClO2 |
| Molecular Weight | 138.59 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | 2-methylpropoxymethyl hypochlorite |
| SMILES | CC(C)COCOCl |
| InChI | InChI=1S/C5H11ClO2/c1-5(2)3-7-4-8-6/h5H,3-4H2,1-2H3 |
| InChIKey | ZLNJSRJAXUNLRB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.59 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropoxymethyl hypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropoxymethyl hypochlorite?
The IUPAC name of 2-methylpropoxymethyl hypochlorite (CID 122692331) is 2-methylpropoxymethyl hypochlorite.
What is the SMILES notation for 2-methylpropoxymethyl hypochlorite?
The canonical SMILES for 2-methylpropoxymethyl hypochlorite is CC(C)COCOCl.
What is the InChIKey of 2-methylpropoxymethyl hypochlorite?
The InChIKey is ZLNJSRJAXUNLRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11ClO2/c1-5(2)3-7-4-8-6/h5H,3-4H2,1-2H3.
What are the key properties of 2-methylpropoxymethyl hypochlorite?
2-methylpropoxymethyl hypochlorite has a molecular weight of 138.59 g/mol, XLogP of 1.79, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropoxymethyl hypochlorite is sourced from PubChem (CID 122692331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).