C15H30O2 — CID 90987862
1,2-bis(2-methylpropoxymethyl)cyclopentane (PubChem CID 90987862) has the molecular formula C15H30O2 and a molecular weight of 242.40 g/mol. Its IUPAC name is 1,2-bis(2-methylpropoxymethyl)cyclopentane.
| Compound Name | 1,2-bis(2-methylpropoxymethyl)cyclopentane |
|---|---|
| PubChem CID | 90987862 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 1,2-bis(2-methylpropoxymethyl)cyclopentane |
| SMILES | CC(C)COCC1CCCC1COCC(C)C |
| InChI | InChI=1S/C15H30O2/c1-12(2)8-16-10-14-6-5-7-15(14)11-17-9-13(3)4/h12-15H,5-11H2,1-4H3 |
| InChIKey | DXHLIRMBNGYOMI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |