C15H21N7O2S — CID 122694432
4-[4-methyl-3-sulfamoyl-2-(2H-tetrazol-5-yl)phenyl]cyclohexane-1-carboximidamide (PubChem CID 122694432) has the molecular formula C15H21N7O2S and a molecular weight of 363.45 g/mol. Its IUPAC name is 4-[4-methyl-3-sulfamoyl-2-(2H-tetrazol-5-yl)phenyl]cyclohexane-1-carboximidamide.
| Compound Name | 4-[4-methyl-3-sulfamoyl-2-(2H-tetrazol-5-yl)phenyl]cyclohexane-1-carboximidamide |
|---|---|
| PubChem CID | 122694432 |
| Molecular Formula | C15H21N7O2S |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 4-[4-methyl-3-sulfamoyl-2-(2H-tetrazol-5-yl)phenyl]cyclohexane-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1CCC(c2ccc(C)c(S(N)(=O)=O)c2-c2nn[nH]n2)CC1 |
| InChI | InChI=1S/C15H21N7O2S/c1-8-2-7-11(9-3-5-10(6-4-9)14(16)17)12(13(8)25(18,23)24)15-19-21-22-20-15/h2,7,9-10H,3-6H2,1H3,(H3,16,17)(H2,18,23,24)(H,19,20,21,22) |
| InChIKey | BFLOEXTXRPJJLI-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 164.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|