C29H32N6O5S — CID 122694827
[10-methylsulfonyl-5-[3-methyl-5-(trideuteriomethyl)triazol-4-yl]-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-13-yl]methoxymethanol (PubChem CID 122694827) has the molecular formula C29H32N6O5S and a molecular weight of 579.70 g/mol. Its IUPAC name is [10-methylsulfonyl-5-[3-methyl-5-(trideuteriomethyl)triazol-4-yl]-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-13-yl]methoxymethanol.
| Compound Name | [10-methylsulfonyl-5-[3-methyl-5-(trideuteriomethyl)triazol-4-yl]-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-13-yl]methoxymethanol |
|---|---|
| PubChem CID | 122694827 |
| Molecular Formula | C29H32N6O5S |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | [10-methylsulfonyl-5-[3-methyl-5-(trideuteriomethyl)triazol-4-yl]-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-13-yl]methoxymethanol |
| SMILES | [2H]C([2H])([2H])c1nnn(C)c1-c1cnc2c3c(COCO)ncc(S(C)(=O)=O)c3n([C@H](c3ccccc3)C3CCOCC3)c2c1 |
| InChI | InChI=1S/C29H32N6O5S/c1-18-27(34(2)33-32-18)21-13-23-26(31-14-21)25-22(16-40-17-36)30-15-24(41(3,37)38)29(25)35(23)28(19-7-5-4-6-8-19)20-9-11-39-12-10-20/h4-8,13-15,20,28,36H,9-12,16-17H2,1-3H3/t28-/m1/s1/i1D3 |
| InChIKey | WJFMWFRAVVDSFR-MLBVKCQFSA-N |
| XLogP | 3.57 |
| TPSA | 134.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|