C28H27ClF2N6O2S — CID 122686361
13-chloro-8-[(4,4-difluorocyclohexyl)-phenylmethyl]-5-(3,5-dimethyltriazol-4-yl)-10-methylsulfonyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 122686361) has the molecular formula C28H27ClF2N6O2S and a molecular weight of 585.08 g/mol. Its IUPAC name is 13-chloro-8-[(4,4-difluorocyclohexyl)-phenylmethyl]-5-(3,5-dimethyltriazol-4-yl)-10-methylsulfonyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 13-chloro-8-[(4,4-difluorocyclohexyl)-phenylmethyl]-5-(3,5-dimethyltriazol-4-yl)-10-methylsulfonyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 122686361 |
| Molecular Formula | C28H27ClF2N6O2S |
| Molecular Weight | 585.08 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | 13-chloro-8-[(4,4-difluorocyclohexyl)-phenylmethyl]-5-(3,5-dimethyltriazol-4-yl)-10-methylsulfonyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Cc1nnn(C)c1-c1cnc2c3c(Cl)ncc(S(C)(=O)=O)c3n(C(c3ccccc3)C3CCC(F)(F)CC3)c2c1 |
| InChI | InChI=1S/C28H27ClF2N6O2S/c1-16-24(36(2)35-34-16)19-13-20-23(32-14-19)22-26(21(40(3,38)39)15-33-27(22)29)37(20)25(17-7-5-4-6-8-17)18-9-11-28(30,31)12-10-18/h4-8,13-15,18,25H,9-12H2,1-3H3 |
| InChIKey | PVYIXAQTVJKYQG-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 95.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.08 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|