C28H30F2N6O3S — CID 145187677
benzene;8-[(4,4-difluorocyclohexyl)methyl]-5-(3,5-dimethyltriazol-4-yl)-10-methylsulfonyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10-pentaen-13-one (PubChem CID 145187677) has the molecular formula C28H30F2N6O3S and a molecular weight of 568.65 g/mol. Its IUPAC name is benzene;8-[(4,4-difluorocyclohexyl)methyl]-5-(3,5-dimethyltriazol-4-yl)-10-methylsulfonyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10-pentaen-13-one.
| Compound Name | benzene;8-[(4,4-difluorocyclohexyl)methyl]-5-(3,5-dimethyltriazol-4-yl)-10-methylsulfonyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10-pentaen-13-one |
|---|---|
| PubChem CID | 145187677 |
| Molecular Formula | C28H30F2N6O3S |
| Molecular Weight | 568.65 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | benzene;8-[(4,4-difluorocyclohexyl)methyl]-5-(3,5-dimethyltriazol-4-yl)-10-methylsulfonyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10-pentaen-13-one |
| SMILES | Cc1nnn(C)c1-c1cnc2c3c(=O)[nH]cc(S(C)(=O)=O)c3n(CC3CCC(F)(F)CC3)c2c1.c1ccccc1 |
| InChI | InChI=1S/C22H24F2N6O3S.C6H6/c1-12-19(29(2)28-27-12)14-8-15-18(25-9-14)17-20(16(34(3,32)33)10-26-21(17)31)30(15)11-13-4-6-22(23,24)7-5-13;1-2-4-6-5-3-1/h8-10,13H,4-7,11H2,1-3H3,(H,26,31);1-6H |
| InChIKey | LKHDFJHBVOWCQJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.65 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|