C21H24N6O2S — CID 139354727
5-(3,5-dimethyltriazol-4-yl)-13-methylsulfinyl-8-(oxan-4-ylmethyl)-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 139354727) has the molecular formula C21H24N6O2S and a molecular weight of 424.53 g/mol. Its IUPAC name is 5-(3,5-dimethyltriazol-4-yl)-13-methylsulfinyl-8-(oxan-4-ylmethyl)-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 5-(3,5-dimethyltriazol-4-yl)-13-methylsulfinyl-8-(oxan-4-ylmethyl)-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 139354727 |
| Molecular Formula | C21H24N6O2S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 5-(3,5-dimethyltriazol-4-yl)-13-methylsulfinyl-8-(oxan-4-ylmethyl)-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Cc1nnn(C)c1-c1cnc2c3c(S(C)=O)nccc3n(CC3CCOCC3)c2c1 |
| InChI | InChI=1S/C21H24N6O2S/c1-13-20(26(2)25-24-13)15-10-17-19(23-11-15)18-16(4-7-22-21(18)30(3)28)27(17)12-14-5-8-29-9-6-14/h4,7,10-11,14H,5-6,8-9,12H2,1-3H3 |
| InChIKey | FKQQEVQFUCTOSO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|