C21H24N6O — CID 139354790
5-(3,5-dimethyltriazol-4-yl)-8-[(1R)-1-(oxan-4-yl)ethyl]-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 139354790) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is 5-(3,5-dimethyltriazol-4-yl)-8-[(1R)-1-(oxan-4-yl)ethyl]-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 5-(3,5-dimethyltriazol-4-yl)-8-[(1R)-1-(oxan-4-yl)ethyl]-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 139354790 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 5-(3,5-dimethyltriazol-4-yl)-8-[(1R)-1-(oxan-4-yl)ethyl]-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Cc1nnn(C)c1-c1cnc2c3cnccc3n([C@H](C)C3CCOCC3)c2c1 |
| InChI | InChI=1S/C21H24N6O/c1-13-21(26(3)25-24-13)16-10-19-20(23-11-16)17-12-22-7-4-18(17)27(19)14(2)15-5-8-28-9-6-15/h4,7,10-12,14-15H,5-6,8-9H2,1-3H3/t14-/m1/s1 |
| InChIKey | MQROWYZBKDKQMY-CQSZACIVSA-N |
| XLogP | 3.68 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |