C24H27N5O3 — CID 144877553
3-[3-(3,5-dimethyltriazol-4-yl)-5-(oxan-4-ylmethyl)pyrido[3,2-b]indol-7-yl]oxetan-3-ol (PubChem CID 144877553) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is 3-[3-(3,5-dimethyltriazol-4-yl)-5-(oxan-4-ylmethyl)pyrido[3,2-b]indol-7-yl]oxetan-3-ol.
| Compound Name | 3-[3-(3,5-dimethyltriazol-4-yl)-5-(oxan-4-ylmethyl)pyrido[3,2-b]indol-7-yl]oxetan-3-ol |
|---|---|
| PubChem CID | 144877553 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 3-[3-(3,5-dimethyltriazol-4-yl)-5-(oxan-4-ylmethyl)pyrido[3,2-b]indol-7-yl]oxetan-3-ol |
| SMILES | Cc1nnn(C)c1-c1cnc2c3ccc(C4(O)COC4)cc3n(CC3CCOCC3)c2c1 |
| InChI | InChI=1S/C24H27N5O3/c1-15-23(28(2)27-26-15)17-9-21-22(25-11-17)19-4-3-18(24(30)13-32-14-24)10-20(19)29(21)12-16-5-7-31-8-6-16/h3-4,9-11,16,30H,5-8,12-14H2,1-2H3 |
| InChIKey | DXHOKDSKAVGREL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|