About 3-propan-2-yl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one
3-propan-2-yl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one (PubChem CID 122697069) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is 3-propan-2-yl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one.
Molecular Properties
| Compound Name | 3-propan-2-yl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one |
| PubChem CID | 122697069 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 3-propan-2-yl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one |
| SMILES | CC(C)c1[nH]nc2c(=O)[nH]ccc12 |
| InChI | InChI=1S/C9H11N3O/c1-5(2)7-6-3-4-10-9(13)8(6)12-11-7/h3-5H,1-2H3,(H,10,13)(H,11,12) |
| InChIKey | RRAZIYWGLSWDNW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-propan-2-yl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one?
The IUPAC name of 3-propan-2-yl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one (CID 122697069) is 3-propan-2-yl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one.
What is the SMILES notation for 3-propan-2-yl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one?
The canonical SMILES for 3-propan-2-yl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one is CC(C)c1[nH]nc2c(=O)[nH]ccc12.
What is the InChIKey of 3-propan-2-yl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one?
The InChIKey is RRAZIYWGLSWDNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O/c1-5(2)7-6-3-4-10-9(13)8(6)12-11-7/h3-5H,1-2H3,(H,10,13)(H,11,12).
What are the key properties of 3-propan-2-yl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one?
3-propan-2-yl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one has a molecular weight of 177.21 g/mol, XLogP of 1.37, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yl-2,6-dihydropyrazolo[3,4-c]pyridin-7-one is sourced from PubChem (CID 122697069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).