C21H19Cl3FN3O2 — CID 122697273
N-[[2-fluoro-4-[(2S,3R)-2-nitroso-3-(3,4,5-trichlorophenyl)pyrrolidin-1-yl]phenyl]methyl]cyclopropanecarboxamide (PubChem CID 122697273) has the molecular formula C21H19Cl3FN3O2 and a molecular weight of 470.76 g/mol. Its IUPAC name is N-[[2-fluoro-4-[(2S,3R)-2-nitroso-3-(3,4,5-trichlorophenyl)pyrrolidin-1-yl]phenyl]methyl]cyclopropanecarboxamide.
| Compound Name | N-[[2-fluoro-4-[(2S,3R)-2-nitroso-3-(3,4,5-trichlorophenyl)pyrrolidin-1-yl]phenyl]methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 122697273 |
| Molecular Formula | C21H19Cl3FN3O2 |
| Molecular Weight | 470.76 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | N-[[2-fluoro-4-[(2S,3R)-2-nitroso-3-(3,4,5-trichlorophenyl)pyrrolidin-1-yl]phenyl]methyl]cyclopropanecarboxamide |
| SMILES | O=N[C@H]1[C@@H](c2cc(Cl)c(Cl)c(Cl)c2)CCN1c1ccc(CNC(=O)C2CC2)c(F)c1 |
| InChI | InChI=1S/C21H19Cl3FN3O2/c22-16-7-13(8-17(23)19(16)24)15-5-6-28(20(15)27-30)14-4-3-12(18(25)9-14)10-26-21(29)11-1-2-11/h3-4,7-9,11,15,20H,1-2,5-6,10H2,(H,26,29)/t15-,20-/m1/s1 |
| InChIKey | UYNMWBPUKIRIMX-FOIQADDNSA-N |
| XLogP | 5.90 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.76 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|